Chemicals
| ChemicalID | ChemGroup | ChemicalName | IUPAC | PubChem | CAS RN ® | Synonyms | Samples |
|---|---|---|---|---|---|---|---|
| CH0000952 |
PAHs Alkylated PAHs |
C2-Chrysene+Benzo(a)anthracene | Sum of dimethylchrysene and dimethylbenzo(a)anthracene | Samples | |||
| CH0000953 |
PAHs Alkylated PAHs |
C3-Chrysene+Benzo(a)anthracene | Sum of trimethylchrysene and trimethylbenzo(a)anthracene | Samples | |||
| CH0000954 | Phenols | Methyl protocatechuate | methyl 3,4-dihydroxybenzoate | 287064 | 2150-43-8 | OH-MeP; 3,4-Dihydroxybenzoic acid methyl ester; Protocatechuic Acid, Methyl Ester; | Samples |
| CH0000955 | Phenols | Ethyl Protocatechuate | ethyl 3,4-dihydroxybenzoate | 77547 | 3943-89-3 | OH-EtP; 3,4-Dihydroxybenzoic acid ethyl ester; ethyl 3,4-dihydroxybenzoate; | Samples |
| CH0000956 | Phenols | 4-Hydroxybenzoic acid | 4-hydroxybenzoic acid | 135 | 99-96-7 | 4-HB; 4-hydroxybenzoate; 4-Carboxyphenol; Paraben-acid; p-Hydroxybenzoic acid; p-hydroxybenzoate | Samples |
| CH0000957 | Phenols | 3,4-Dihydroxybenzoic acid | 3,4-dihydroxybenzoic acid | 72 | 99-50-3 | 4-HB; 4-hydroxybenzoate; 4-Carboxyphenol; Paraben-acid; p-Hydroxybenzoic acid; p-hydroxybenzoate | Samples |
| CH0000958 |
Organochlorines Dioxins PCDFs |
1,2,7,8-TeCDF | 1,2,7,8-tetrachlorodibenzofuran | 42844 | 58802-20-3 | 1,2,7,8-TCDF; 1,2,7,8-tetrachlorodibenzofuran; PCDF 61 | Samples |
| CH0000959 |
Organochlorines Dioxins PCDFs |
1,2,3,7,8-PeCDF | 1,2,3,7,8-pentachlorodibenzofuran | 42138 | 57117-41-6 | 1,2,3,7,8-PCDBF; 1,2,3,7,8-pentachlorodibenzofuran; PCDF 94; 12378-PCDF | Samples |
| CH0000960 |
Organochlorines Dioxins |
Total Dioxins | Sum of PCDDs, PCDFs and DL-PCB | Samples | |||
| CH0000961 |
Organochlorines Dioxins PBDDs |
1,3,6,8-TeBDD | 1,3,6,8-tetrabromodibenzo-p-dioxin | 93458 | 76584-71-9 | 1,3,6,8-Tetrabromodibenzo-p-dioxin; 1,3,6,8-tetrabromooxanthrene; | Samples |
| CH0000962 |
Organochlorines Dioxins PBDDs |
1,3,7,9-TeBDD | 1,3,7,9-tetrabromodibenzo-p-dioxin | 86291 | 109333-30-4 | 1,3,7,9-Tetrabromodibenzo-p-dioxin; 1,3,7,9-Tetrabromodibenzodioxin; 1,3,7,9-Tetrabromodibenzo(p)dioxin; 2,4,6,8-Tetrabromodibenzo-p-dioxin | Samples |
| CH0000963 |
Organochlorines Dioxins PBDDs |
1,2,3,4-TeBDD | 1,2,3,4-tetrabromodibenzo-p-dioxin | 92429 | 104549-41-9 | 1,2,3,4-Tetrabromodibenzo-p-dioxin; 1,2,3,4-Tetrabromodibenzo[b,e][1,4]dioxin; | Samples |
| CH0000964 |
Organochlorines Dioxins PBDDs |
1,3,7,8-TeBDD | 1,3,7,8-tetrabromodibenzo-p-dioxin | 184065 | 109333-31-5 | 1,3,7,8-Tetrabromodibenzodioxin; 1,3,7,8-Tetrabromodibenzo[b,e][1,4]dioxin; 1,3,7,8-Tetrabromodibenzo(p)dioxin; 1,3,7,8-Tetrabromodibenzo-p-dioxin | Samples |
| CH0000965 |
Organochlorines Dioxins PBDDs |
1,2,3,6,7,8-HxBDD | 1,2,3,6,7,8-hexabromodibenzo-p-dioxin | 86301 | 110999-45-6 | 1,2,3,6,7,8-Hexabromodibenzo-p-dioxin; 1,2,3,6,7,8-Hexabromodibenzo[b,e][1,4]dioxin; 1,2,3,6,7,8-hexabromodibenzodioxin | Samples |
| CH0000966 |
Organochlorines Dioxins PXDDs |
1-B-2,3,7,8-TeCDD | 1-bromo-2,3,7,8-tetrachlorodibenzo-p-dioxin | 184316 | 104549-42-0 | 1-Bromo-2,3,7,8-Tetrachlorodibenzodioxin; 1-Bromo-2,3,7,8-tetrachlorodibenzo[b,e][1,4]dioxin; 1-bromo-2,3,7,8-tetrachloro-dibenzo-p-dioxin; | Samples |
| CH0000967 |
Organochlorines Dioxins PXDDs |
2-B-3,6,7,8,9-PeCDD | 7-bromo-1,2,3,4,8-pentachlorodibenzo-p-dioxin | 12087238 | 142497-24-3 | 2-Bromo-3,6,7,8,9-pentachlorodibenzo-p-dioxin; 2-Bromo-3,6,7,8,9-pentachlorodibenzodioxin; 7-Bromo-1,2,3,4,8-pentachlorodibenzo[b,e][1,4]dioxin | Samples |
| CH0000968 |
Organochlorines Dioxins PXDDs |
Σ MoBPeDDs | Sum of Monobromo-pentachlorodibenzo-p-dioxins | Samples | |||
| CH0000969 |
Organochlorines Dioxins PXDDs |
1-B-2,3,6,7,8,9-HxCDD | 6-bromo-1,2,3,4,7,8-hexachlorodibenzo-p-dioxin | 12087239 | 502718-30-1 | 1-Bromo-2,3,6,7,8,9-hexachlorodibenzo-p-dioxin; 6-Bromo-1,2,3,4,7,8-hexachlorodibenzo[b,e][1,4]dioxin | Samples |
| CH0000970 |
Organochlorines Dioxins PXDDs |
Σ MoBHxCDDs | Sum of Monobromo-hexachlorodibenzo-p-dioxins | Samples | |||
| CH0000971 |
Organochlorines Dioxins PXDDs |
1-B-2,3,4,6,7,8,9-HpCDD | 1-bromo-2,3,4,6,7,8,9-heptachlorodibenzo-p-dioxin | 526390 | 136471-79-9 | 1-Bromo-2,3,4,6,7,8,9-heptachlorodibenzo[b,e][1,4]dioxin; | Samples |
| CH0000972 |
Organochlorines Dioxins PXDDs |
Σ MoBHpCDDs | Sum of Monobromo-heptachlorodibenzo-p-dioxins | Samples | |||
| CH0000973 |
Organochlorines Dioxins PXDDs |
Total MoBPCDDs | Sum of Monobromo-polychlorodibenzo-p-dioxins | Samples | |||
| CH0000974 |
Organochlorines Dioxins PXDFs |
1-B-2,3,7,8-TeCDF | 1-bromo-2,3,7,8-tetrachlorodibenzofuran | 184317 | 104549-43-1 | 1-Bromo-2,3,7,8-tetrachlorodibenzofuran; 1-bromo-2,3,7,8-tetrachlorodibenzo[b,d]furan; Dibenzofuran, 1-bromo-2,3,7,8-tetrachloro-; | Samples |
| CH0000975 |
Organochlorines Dioxins PXDFs |
ΣMoBPeCDFs | Sum of Monobromo-pentachlorodibenzofurans | Samples | |||
| CH0000976 |
Organochlorines Dioxins PXDFs |
ΣMoBHxCDFs | Sum of Monobromo-hexachlorodibenzofurans | Samples | |||
| CH0000977 |
Organochlorines Dioxins PXDFs |
ΣMoBHpCDFs | Sum of Monobromo-heptachlorodibenzofurans | Samples | |||
| CH0000978 |
Organochlorines Dioxins PXDFs |
ΣTotal MoBPCDFs | Sum of Monobromo-polychlorodibenzofurans | Samples | |||
| CH0000979 |
Organochlorines Dioxins |
ΣTotal MoBPCDDs/DFs | Sum of Monobromo-polychlorodibenzo-p-dioxins and Monobromo-polychlorodibenzofurans | Samples | |||
| CH0000980 |
PPCPs Detergents |
LAS | 23707964 | 68081-81-2 | Linear alkyl benzene sulfonate | Samples | |
| CH0000981 |
Phenols Alkylphenols |
4-Tert-octylphenol | 4-(2,4,4-trimethylpentan-2-yl)phenol | 8814 | 140-66-9 | 4-tert-octylphenol; 4-t-octylphenol; p-Octylphenol; p-t-Octylphenol; 4-(1,1,3,3-Tetramethylbutyl)phenol | Samples |
| CH0000982 |
PPCPs Detergents |
ΣLABs | 67774-74-7 | Samples | |||
| CH0000983 |
PAHs PAHs |
benzo[j]fluoranthene | InChI=1S/C20H12/c1-2-8-15-13(5-1)11-12-17-16-9-3-6-14-7-4-10-18(19(14)16)20(15)17/h1-12H | 9152 | 205-82-3 | benzo(j)fluoranthene; Benzo[j]fluoranthene; 10,11-Benzofluoranthene; 7,8-Benzfluoranthene; Dibenzo[a,jk]fluorene | Samples |
| CH0000984 |
PAHs PAHs |
coronene | coronene | 9115 | 191-07-1 | Coronene; Hexabenzobenzene; Dibenzo(ghi,pqr)perylene; Circumbenzene | Samples |
| CH0000985 |
Flame retardants BFRs PXDEs |
ΣTrBMoCDEs | Sum of Tribromo-monochloro diphenyl ethers | Samples | |||
| CH0000986 |
Flame retardants BFRs PXDEs |
ΣDiBDiCDEs | Sum of Dibromo-dichloro diphenyl ethers | Samples | |||
| CH0000987 |
Flame retardants BFRs PXDEs |
ΣMoBTrCDEs | Sum of Monobromo-trichloro diphenyl ethers | Samples | |||
| CH0000988 |
Organochlorines PCDEs |
ΣTeCDEs | Sum of Tetrachloro diphenyl ethers | Samples | |||
| CH0000989 |
Flame retardants BFRs PXDEs |
ΣTeBMoCDEs | Sum of Tetrabromo-monochloro diphenyl ethers | Samples | |||
| CH0000990 |
Flame retardants BFRs PXDEs |
ΣTrBDiCDEs | Sum of Tribromo-dichloro diphenyl ethers | Samples | |||
| CH0000991 |
Flame retardants BFRs PXDEs |
ΣDiBTrCDEs | Sum of Dibromo-trichloro diphenyl ethers | Samples | |||
| CH0000992 |
Flame retardants BFRs PXDEs |
ΣMoBTeCDEs | Sum of Monobromo-tetrachloro diphenyl ethers | Samples | |||
| CH0000993 |
Organochlorines PCDEs |
ΣPeCDEs | Sum of Pentachloro diphenyl ethers | Samples | |||
| CH0000994 |
Flame retardants BFRs PXDEs |
ΣPeBMoCDEs | Sum of Pentabromo-monochloro diphenyl ethers | Samples | |||
| CH0000995 |
Flame retardants BFRs PXDEs |
ΣTeBDiCDEs | Sum of Tetrabromo-dichloro diphenyl ethers | Samples | |||
| CH0000996 |
Flame retardants BFRs PXDEs |
ΣTrBTrCDEs | Sum of tribromo-trichloro diphenyl ethers | Samples | |||
| CH0000997 |
Flame retardants BFRs PXDEs |
ΣDiBTeCDEs | Sum of Dibromo-tetrachloro diphenyl ethers | Samples | |||
| CH0000998 |
Flame retardants BFRs PXDEs |
ΣMoBPeCDEs | Sum of Monobromo-Pentachloro diphenyl ethers | Samples | |||
| CH0000999 |
Organochlorines PCDEs |
ΣHxCDEs | Sum of Hexachloro diphenyl ethers | Samples | |||
| CH0001000 |
Flame retardants BFRs PXDEs |
ΣHxBMoCDEs | Sum of Hexabromo-monochloro diphenyl ethers | Samples | |||
| CH0001001 |
Flame retardants BFRs PXDEs |
ΣPeBDiCDEs | Sum of Pentabromo-dichloro diphenyl ethers | Samples |